C20H35N6O14P3 — CID 146373805
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] but-3-ynyl phosphono phosphate;N,N-diethylethanamine (PubChem CID 146373805) has the molecular formula C20H35N6O14P3 and a molecular weight of 676.45 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] but-3-ynyl phosphono phosphate;N,N-diethylethanamine.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] but-3-ynyl phosphono phosphate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 146373805 |
| Molecular Formula | C20H35N6O14P3 |
| Molecular Weight | 676.45 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] but-3-ynyl phosphono phosphate;N,N-diethylethanamine |
| SMILES | C#CCCOP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O.CCN(CC)CC |
| InChI | InChI=1S/C14H20N5O14P3.C6H15N/c1-2-3-4-29-36(28,32-34(23,24)25)33-35(26,27)30-5-7-9(20)10(21)13(31-7)19-6-16-8-11(19)17-14(15)18-12(8)22;1-4-7(5-2)6-3/h1,6-7,9-10,13,20-21H,3-5H2,(H,26,27)(H2,23,24,25)(H3,15,17,18,22);4-6H2,1-3H3/t7-,9-,10-,13-,36?;/m1./s1 |
| InChIKey | HIMNAXTVWLHBLQ-OKJPDMGBSA-N |
| XLogP | 0.06 |
| TPSA | 291.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|