C17H25F3N2O7S — CID 146374376
[2-(2-methylprop-2-enoyloxy)-7-(trifluoromethylsulfonylcarbamoylamino)heptyl] 2-methylprop-2-enoate (PubChem CID 146374376) has the molecular formula C17H25F3N2O7S and a molecular weight of 458.46 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxy)-7-(trifluoromethylsulfonylcarbamoylamino)heptyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxy)-7-(trifluoromethylsulfonylcarbamoylamino)heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146374376 |
| Molecular Formula | C17H25F3N2O7S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxy)-7-(trifluoromethylsulfonylcarbamoylamino)heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCNC(=O)NS(=O)(=O)C(F)(F)F)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H25F3N2O7S/c1-11(2)14(23)28-10-13(29-15(24)12(3)4)8-6-5-7-9-21-16(25)22-30(26,27)17(18,19)20/h13H,1,3,5-10H2,2,4H3,(H2,21,22,25) |
| InChIKey | SJVDCTFIJLPNFW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|