C8H8Cl4N2 — CID 14637616
2,3,5,6-tetrakis(chloromethyl)pyrazine (PubChem CID 14637616) has the molecular formula C8H8Cl4N2 and a molecular weight of 273.98 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(chloromethyl)pyrazine.
| Compound Name | 2,3,5,6-tetrakis(chloromethyl)pyrazine |
|---|---|
| PubChem CID | 14637616 |
| Molecular Formula | C8H8Cl4N2 |
| Molecular Weight | 273.98 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 2,3,5,6-tetrakis(chloromethyl)pyrazine |
| SMILES | ClCc1nc(CCl)c(CCl)nc1CCl |
| InChI | InChI=1S/C8H8Cl4N2/c9-1-5-6(2-10)14-8(4-12)7(3-11)13-5/h1-4H2 |
| InChIKey | MAQHHIOUIMDDTD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.98 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|