C66H61N3 — CID 146376598
10,18-bis(3,6-ditert-butylcarbazol-9-yl)-1-azaheptacyclo[14.10.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2,4,6,8,10,12(27),13,15,17,19,21,23,25-tridecaene (PubChem CID 146376598) has the molecular formula C66H61N3 and a molecular weight of 896.24 g/mol. Its IUPAC name is 10,18-bis(3,6-ditert-butylcarbazol-9-yl)-1-azaheptacyclo[14.10.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2,4,6,8,10,12(27),13,15,17,19,21,23,25-tridecaene.
| Compound Name | 10,18-bis(3,6-ditert-butylcarbazol-9-yl)-1-azaheptacyclo[14.10.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2,4,6,8,10,12(27),13,15,17,19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 146376598 |
| Molecular Formula | C66H61N3 |
| Molecular Weight | 896.24 g/mol |
| Exact Mass | 895.49 |
| IUPAC Name | 10,18-bis(3,6-ditert-butylcarbazol-9-yl)-1-azaheptacyclo[14.10.1.02,11.04,9.012,27.017,26.019,24]heptacosa-2,4,6,8,10,12(27),13,15,17,19,21,23,25-tridecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c2ccccc2cc2c1c1cccc3c4c(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)c5ccccc5cc4n2c13 |
| InChI | InChI=1S/C66H61N3/c1-63(2,3)40-24-28-52-48(34-40)49-35-41(64(4,5)6)25-29-53(49)67(52)61-44-20-15-13-18-38(44)32-56-58(61)46-22-17-23-47-59-57(69(56)60(46)47)33-39-19-14-16-21-45(39)62(59)68-54-30-26-42(65(7,8)9)36-50(54)51-37-43(66(10,11)12)27-31-55(51)68/h13-37H,1-12H3 |
| InChIKey | WLPDLCCSNDXNIV-UHFFFAOYSA-N |
| XLogP | 18.53 |
| TPSA | 14.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.24 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |