C80H70N2Se — CID 159766779
3,6-ditert-butyl-9-[10-[6-[10-(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]dibenzoselenophen-1-yl]anthracen-9-yl]carbazole (PubChem CID 159766779) has the molecular formula C80H70N2Se and a molecular weight of 1138.41 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[10-[6-[10-(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]dibenzoselenophen-1-yl]anthracen-9-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[10-[6-[10-(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]dibenzoselenophen-1-yl]anthracen-9-yl]carbazole |
|---|---|
| PubChem CID | 159766779 |
| Molecular Formula | C80H70N2Se |
| Molecular Weight | 1138.41 g/mol |
| Exact Mass | 1138.47 |
| IUPAC Name | 3,6-ditert-butyl-9-[10-[6-[10-(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]dibenzoselenophen-1-yl]anthracen-9-yl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c2ccccc2c(-c2cccc3c2[se]c2cccc(-c4c5ccccc5c(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)c5ccccc45)c23)c2ccccc12 |
| InChI | InChI=1S/C80H70N2Se/c1-77(2,3)47-35-39-66-62(43-47)63-44-48(78(4,5)6)36-40-67(63)81(66)74-55-27-17-13-23-51(55)71(52-24-14-18-28-56(52)74)59-31-22-34-70-73(59)61-33-21-32-60(76(61)83-70)72-53-25-15-19-29-57(53)75(58-30-20-16-26-54(58)72)82-68-41-37-49(79(7,8)9)45-64(68)65-46-50(80(10,11)12)38-42-69(65)82/h13-46H,1-12H3 |
| InChIKey | DTMJFOIKFJRCPB-UHFFFAOYSA-N |
| XLogP | 22.38 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.41 |
| LogP ≤ 5 | 22.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|