C16H27Cl2IN2 — CID 146378856
3,4-dichloro-5-iodo-1-(5-methyldodecan-5-yl)pyrazole (PubChem CID 146378856) has the molecular formula C16H27Cl2IN2 and a molecular weight of 445.22 g/mol. Its IUPAC name is 3,4-dichloro-5-iodo-1-(5-methyldodecan-5-yl)pyrazole.
| Compound Name | 3,4-dichloro-5-iodo-1-(5-methyldodecan-5-yl)pyrazole |
|---|---|
| PubChem CID | 146378856 |
| Molecular Formula | C16H27Cl2IN2 |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 3,4-dichloro-5-iodo-1-(5-methyldodecan-5-yl)pyrazole |
| SMILES | CCCCCCCC(C)(CCCC)n1nc(Cl)c(Cl)c1I |
| InChI | InChI=1S/C16H27Cl2IN2/c1-4-6-8-9-10-12-16(3,11-7-5-2)21-15(19)13(17)14(18)20-21/h4-12H2,1-3H3 |
| InChIKey | ODNJBAADCKLTJX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|