C17H28Cl2F2N2 — CID 146378886
4,5-dichloro-3-(difluoromethyl)-1-(5-methyldodecan-5-yl)pyrazole (PubChem CID 146378886) has the molecular formula C17H28Cl2F2N2 and a molecular weight of 369.33 g/mol. Its IUPAC name is 4,5-dichloro-3-(difluoromethyl)-1-(5-methyldodecan-5-yl)pyrazole.
| Compound Name | 4,5-dichloro-3-(difluoromethyl)-1-(5-methyldodecan-5-yl)pyrazole |
|---|---|
| PubChem CID | 146378886 |
| Molecular Formula | C17H28Cl2F2N2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4,5-dichloro-3-(difluoromethyl)-1-(5-methyldodecan-5-yl)pyrazole |
| SMILES | CCCCCCCC(C)(CCCC)n1nc(C(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C17H28Cl2F2N2/c1-4-6-8-9-10-12-17(3,11-7-5-2)23-15(19)13(18)14(22-23)16(20)21/h16H,4-12H2,1-3H3 |
| InChIKey | QYTSXZCSEPQVJE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|