C16H27Br3N2 — CID 146378900
3,4,5-tribromo-1-(5-methyldodecan-5-yl)pyrazole (PubChem CID 146378900) has the molecular formula C16H27Br3N2 and a molecular weight of 487.12 g/mol. Its IUPAC name is 3,4,5-tribromo-1-(5-methyldodecan-5-yl)pyrazole.
| Compound Name | 3,4,5-tribromo-1-(5-methyldodecan-5-yl)pyrazole |
|---|---|
| PubChem CID | 146378900 |
| Molecular Formula | C16H27Br3N2 |
| Molecular Weight | 487.12 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | 3,4,5-tribromo-1-(5-methyldodecan-5-yl)pyrazole |
| SMILES | CCCCCCCC(C)(CCCC)n1nc(Br)c(Br)c1Br |
| InChI | InChI=1S/C16H27Br3N2/c1-4-6-8-9-10-12-16(3,11-7-5-2)21-15(19)13(17)14(18)20-21/h4-12H2,1-3H3 |
| InChIKey | IEYLZPHIZMUFEJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.12 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|