C20H26N4 — CID 146380484
4-(4-amino-2,3-dihydro-1H-inden-5-yl)-N-(1-methylpiperidin-4-yl)pyridin-2-amine (PubChem CID 146380484) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-(4-amino-2,3-dihydro-1H-inden-5-yl)-N-(1-methylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | 4-(4-amino-2,3-dihydro-1H-inden-5-yl)-N-(1-methylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 146380484 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 4-(4-amino-2,3-dihydro-1H-inden-5-yl)-N-(1-methylpiperidin-4-yl)pyridin-2-amine |
| SMILES | CN1CCC(Nc2cc(-c3ccc4c(c3N)CCC4)ccn2)CC1 |
| InChI | InChI=1S/C20H26N4/c1-24-11-8-16(9-12-24)23-19-13-15(7-10-22-19)18-6-5-14-3-2-4-17(14)20(18)21/h5-7,10,13,16H,2-4,8-9,11-12,21H2,1H3,(H,22,23) |
| InChIKey | RUFBDBLYXQVQPN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|