C22H28N4O2S — CID 153403889
1-[5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea (PubChem CID 153403889) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea.
| Compound Name | 1-[5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
|---|---|
| PubChem CID | 153403889 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
| SMILES | CSNC(=O)Nc1c(-c2ccnc(OC3CCN(C)CC3)c2)ccc2c1CCC2 |
| InChI | InChI=1S/C22H28N4O2S/c1-26-12-9-17(10-13-26)28-20-14-16(8-11-23-20)19-7-6-15-4-3-5-18(15)21(19)24-22(27)25-29-2/h6-8,11,14,17H,3-5,9-10,12-13H2,1-2H3,(H2,24,25,27) |
| InChIKey | PWZRWFOTGBEMFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|