C18H19N3OS — CID 170600876
1-[5-(2-ethenyl-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea (PubChem CID 170600876) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-[5-(2-ethenyl-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea.
| Compound Name | 1-[5-(2-ethenyl-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
|---|---|
| PubChem CID | 170600876 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-[5-(2-ethenyl-4-pyridinyl)-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
| SMILES | C=Cc1cc(-c2ccc3c(c2NC(=O)NSC)CCC3)ccn1 |
| InChI | InChI=1S/C18H19N3OS/c1-3-14-11-13(9-10-19-14)16-8-7-12-5-4-6-15(12)17(16)20-18(22)21-23-2/h3,7-11H,1,4-6H2,2H3,(H2,20,21,22) |
| InChIKey | IBFOHNCWZGDAGZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|