C20H23N3O3S — CID 170600864
1-[5-[1-(1-hydroxybut-3-en-2-yl)-2-oxo-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea (PubChem CID 170600864) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[5-[1-(1-hydroxybut-3-en-2-yl)-2-oxo-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea.
| Compound Name | 1-[5-[1-(1-hydroxybut-3-en-2-yl)-2-oxo-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
|---|---|
| PubChem CID | 170600864 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[5-[1-(1-hydroxybut-3-en-2-yl)-2-oxo-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]-3-methylsulfanylurea |
| SMILES | C=CC(CO)n1ccc(-c2ccc3c(c2NC(=O)NSC)CCC3)cc1=O |
| InChI | InChI=1S/C20H23N3O3S/c1-3-15(12-24)23-10-9-14(11-18(23)25)17-8-7-13-5-4-6-16(13)19(17)21-20(26)22-27-2/h3,7-11,15,24H,1,4-6,12H2,2H3,(H2,21,22,26) |
| InChIKey | JOHGAUKDKJVLBQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|