C26H26N6O2S — CID 170126274
1-[(4-cyclopropyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)sulfanyl]-3-(5-imidazo[1,2-a]pyridin-7-yl-2,3-dihydro-1H-inden-4-yl)urea (PubChem CID 170126274) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 1-[(4-cyclopropyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)sulfanyl]-3-(5-imidazo[1,2-a]pyridin-7-yl-2,3-dihydro-1H-inden-4-yl)urea.
| Compound Name | 1-[(4-cyclopropyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)sulfanyl]-3-(5-imidazo[1,2-a]pyridin-7-yl-2,3-dihydro-1H-inden-4-yl)urea |
|---|---|
| PubChem CID | 170126274 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[(4-cyclopropyl-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl)sulfanyl]-3-(5-imidazo[1,2-a]pyridin-7-yl-2,3-dihydro-1H-inden-4-yl)urea |
| SMILES | O=C(NSc1cc2n(n1)CCOC2C1CC1)Nc1c(-c2ccn3ccnc3c2)ccc2c1CCC2 |
| InChI | InChI=1S/C26H26N6O2S/c33-26(30-35-23-15-21-25(17-4-5-17)34-13-12-32(21)29-23)28-24-19-3-1-2-16(19)6-7-20(24)18-8-10-31-11-9-27-22(31)14-18/h6-11,14-15,17,25H,1-5,12-13H2,(H2,28,30,33) |
| InChIKey | UMMBIWLHTDJVRS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|