C24H30N6O3S — CID 146380505
1-(N-cyano-S-methylsulfonimidoyl)-3-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]urea (PubChem CID 146380505) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 1-(N-cyano-S-methylsulfonimidoyl)-3-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]urea.
| Compound Name | 1-(N-cyano-S-methylsulfonimidoyl)-3-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]urea |
|---|---|
| PubChem CID | 146380505 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-(N-cyano-S-methylsulfonimidoyl)-3-[6-methyl-5-[2-(1-methylpiperidin-4-yl)oxy-4-pyridinyl]-2,3-dihydro-1H-inden-4-yl]urea |
| SMILES | Cc1cc2c(c(NC(=O)NS(C)(=O)=NC#N)c1-c1ccnc(OC3CCN(C)CC3)c1)CCC2 |
| InChI | InChI=1S/C24H30N6O3S/c1-16-13-17-5-4-6-20(17)23(28-24(31)29-34(3,32)27-15-25)22(16)18-7-10-26-21(14-18)33-19-8-11-30(2)12-9-19/h7,10,13-14,19H,4-6,8-9,11-12H2,1-3H3,(H2,27,28,29,31,32) |
| InChIKey | HWVZGSGPQJVFDH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|