C28H37BN5O4S — CID 170600790
CID 170600790 (PubChem CID 170600790) has the molecular formula C28H37BN5O4S and a molecular weight of 550.51 g/mol.
| Compound Name | CID 170600790 |
|---|---|
| PubChem CID | 170600790 |
| Molecular Formula | C28H37BN5O4S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(c(NC(=O)NS/C(N)=C/C=N/CC(C)(C)[B]O)c1-c1ccnc(OC3CCOCC3)c1)CCC2 |
| InChI | InChI=1S/C28H37BN5O4S/c1-18-15-19-5-4-6-22(19)26(33-27(35)34-39-23(30)8-11-31-17-28(2,3)29-36)25(18)20-7-12-32-24(16-20)38-21-9-13-37-14-10-21/h7-8,11-12,15-16,21,36H,4-6,9-10,13-14,17,30H2,1-3H3,(H2,33,34,35)/b23-8+,31-11+ |
| InChIKey | JSBBYAKMFJBBIX-MKOWJCBFSA-N |
| XLogP | 4.55 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|