C27H29N3O3 — CID 146388650
benzyl 4-[[4-(4-amino-2,3-dihydro-1H-inden-5-yl)-2-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 146388650) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is benzyl 4-[[4-(4-amino-2,3-dihydro-1H-inden-5-yl)-2-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[4-(4-amino-2,3-dihydro-1H-inden-5-yl)-2-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146388650 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | benzyl 4-[[4-(4-amino-2,3-dihydro-1H-inden-5-yl)-2-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | Nc1c(-c2ccnc(OC3CCN(C(=O)OCc4ccccc4)CC3)c2)ccc2c1CCC2 |
| InChI | InChI=1S/C27H29N3O3/c28-26-23-8-4-7-20(23)9-10-24(26)21-11-14-29-25(17-21)33-22-12-15-30(16-13-22)27(31)32-18-19-5-2-1-3-6-19/h1-3,5-6,9-11,14,17,22H,4,7-8,12-13,15-16,18,28H2 |
| InChIKey | XLJPZZCBEVOWAF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|