C5H7N3O2S — CID 146382309
2-(1,3,4-thiadiazol-2-yl)ethylcarbamic acid (PubChem CID 146382309) has the molecular formula C5H7N3O2S and a molecular weight of 173.20 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-yl)ethylcarbamic acid.
| Compound Name | 2-(1,3,4-thiadiazol-2-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 146382309 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-yl)ethylcarbamic acid |
| SMILES | O=C(O)NCCc1nncs1 |
| InChI | InChI=1S/C5H7N3O2S/c9-5(10)6-2-1-4-8-7-3-11-4/h3,6H,1-2H2,(H,9,10) |
| InChIKey | XOIIVDUONUJOBM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |