C19H19N5O3 — CID 146383760
4-[2-[[ethoxy(hydroxy)methyl]amino]-6-methyl-1H-benzimidazol-5-yl]-2H-phthalazin-1-one (PubChem CID 146383760) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[2-[[ethoxy(hydroxy)methyl]amino]-6-methyl-1H-benzimidazol-5-yl]-2H-phthalazin-1-one.
| Compound Name | 4-[2-[[ethoxy(hydroxy)methyl]amino]-6-methyl-1H-benzimidazol-5-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 146383760 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[2-[[ethoxy(hydroxy)methyl]amino]-6-methyl-1H-benzimidazol-5-yl]-2H-phthalazin-1-one |
| SMILES | CCOC(O)Nc1nc2cc(-c3n[nH]c(=O)c4ccccc34)c(C)cc2[nH]1 |
| InChI | InChI=1S/C19H19N5O3/c1-3-27-19(26)22-18-20-14-8-10(2)13(9-15(14)21-18)16-11-6-4-5-7-12(11)17(25)24-23-16/h4-9,19,26H,3H2,1-2H3,(H,24,25)(H2,20,21,22) |
| InChIKey | LQVZQMDYRXNQFN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|