C20H21FN6O3 — CID 146383801
4-[2-[[2-(dimethylamino)ethoxy-hydroxymethyl]amino]-3H-benzimidazol-5-yl]-6-fluoro-2H-phthalazin-1-one (PubChem CID 146383801) has the molecular formula C20H21FN6O3 and a molecular weight of 412.43 g/mol. Its IUPAC name is 4-[2-[[2-(dimethylamino)ethoxy-hydroxymethyl]amino]-3H-benzimidazol-5-yl]-6-fluoro-2H-phthalazin-1-one.
| Compound Name | 4-[2-[[2-(dimethylamino)ethoxy-hydroxymethyl]amino]-3H-benzimidazol-5-yl]-6-fluoro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 146383801 |
| Molecular Formula | C20H21FN6O3 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[2-[[2-(dimethylamino)ethoxy-hydroxymethyl]amino]-3H-benzimidazol-5-yl]-6-fluoro-2H-phthalazin-1-one |
| SMILES | CN(C)CCOC(O)Nc1nc2ccc(-c3n[nH]c(=O)c4ccc(F)cc34)cc2[nH]1 |
| InChI | InChI=1S/C20H21FN6O3/c1-27(2)7-8-30-20(29)24-19-22-15-6-3-11(9-16(15)23-19)17-14-10-12(21)4-5-13(14)18(28)26-25-17/h3-6,9-10,20,29H,7-8H2,1-2H3,(H,26,28)(H2,22,23,24) |
| InChIKey | LYRCFJADQSKPGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|