C22H25F3N6O4 — CID 146386894
(4aR,8aS)-6-[4-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenoxy]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 146386894) has the molecular formula C22H25F3N6O4 and a molecular weight of 494.47 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenoxy]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenoxy]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 146386894 |
| Molecular Formula | C22H25F3N6O4 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (4aR,8aS)-6-[4-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenoxy]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CCC(Oc4cc(-n5cncn5)cc(C(F)(F)F)c4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C22H25F3N6O4/c23-22(24,25)14-7-15(31-13-26-12-27-31)9-17(8-14)35-16-1-4-29(5-2-16)21(33)30-6-3-19-18(10-30)28-20(32)11-34-19/h7-9,12-13,16,18-19H,1-6,10-11H2,(H,28,32)/t18-,19+/m1/s1 |
| InChIKey | RNQHDADJQMSVEM-MOPGFXCFSA-N |
| XLogP | 1.84 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |