C13H16ClFNO2P — CID 146390524
N-[4-chloro-3-[(3-fluoro-3-phosphanylcyclobutyl)methoxy]phenyl]acetamide (PubChem CID 146390524) has the molecular formula C13H16ClFNO2P and a molecular weight of 303.70 g/mol. Its IUPAC name is N-[4-chloro-3-[(3-fluoro-3-phosphanylcyclobutyl)methoxy]phenyl]acetamide.
| Compound Name | N-[4-chloro-3-[(3-fluoro-3-phosphanylcyclobutyl)methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 146390524 |
| Molecular Formula | C13H16ClFNO2P |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[4-chloro-3-[(3-fluoro-3-phosphanylcyclobutyl)methoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(OCC2CC(F)(P)C2)c1 |
| InChI | InChI=1S/C13H16ClFNO2P/c1-8(17)16-10-2-3-11(14)12(4-10)18-7-9-5-13(15,19)6-9/h2-4,9H,5-7,19H2,1H3,(H,16,17) |
| InChIKey | RFBSVWGQUYIASM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|