C25H24N2O — CID 14639201
phenyl-(4,4,5-trimethyl-3,5-diphenylpyrazol-1-yl)methanone (PubChem CID 14639201) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is phenyl-(4,4,5-trimethyl-3,5-diphenylpyrazol-1-yl)methanone.
| Compound Name | phenyl-(4,4,5-trimethyl-3,5-diphenylpyrazol-1-yl)methanone |
|---|---|
| PubChem CID | 14639201 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | phenyl-(4,4,5-trimethyl-3,5-diphenylpyrazol-1-yl)methanone |
| SMILES | CC1(C)C(c2ccccc2)=NN(C(=O)c2ccccc2)C1(C)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O/c1-24(2)22(19-13-7-4-8-14-19)26-27(23(28)20-15-9-5-10-16-20)25(24,3)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | UFEPSBOKIZSGDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |