C11H20O4 — CID 146396742
1-[[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]ethanol (PubChem CID 146396742) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]ethanol.
| Compound Name | 1-[[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 146396742 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-[[(1R,4S,5S,7S,8S)-4,8-dimethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]methoxy]ethanol |
| SMILES | CC(O)OC[C@@H]1O[C@@H]2[C@H](C)[C@H]1OC[C@@H]2C |
| InChI | InChI=1S/C11H20O4/c1-6-4-14-11-7(2)10(6)15-9(11)5-13-8(3)12/h6-12H,4-5H2,1-3H3/t6-,7-,8?,9-,10-,11+/m0/s1 |
| InChIKey | WSQQYDUAEWBBPS-ZKRNKITMSA-N |
| XLogP | 0.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|