C12H24O7 — CID 166083245
1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol (PubChem CID 166083245) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol.
| Compound Name | 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol |
|---|---|
| PubChem CID | 166083245 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol |
| SMILES | COCC(O)OC[C@H]1OC[C@H](OC(O)COC)[C@H]1C |
| InChI | InChI=1S/C12H24O7/c1-8-9(4-18-11(13)6-15-2)17-5-10(8)19-12(14)7-16-3/h8-14H,4-7H2,1-3H3/t8-,9+,10-,11?,12?/m0/s1 |
| InChIKey | JFZGJEWHPMOJRH-IDSCEKSVSA-N |
| XLogP | -0.65 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|