About 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol
1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol (PubChem CID 166083245) has the molecular formula C12H24O7
and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol.
Molecular Properties
| Compound Name | 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol |
| PubChem CID | 166083245 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol |
| SMILES | COCC(O)OC[C@H]1OC[C@H](OC(O)COC)[C@H]1C |
| InChI | InChI=1S/C12H24O7/c1-8-9(4-18-11(13)6-15-2)17-5-10(8)19-12(14)7-16-3/h8-14H,4-7H2,1-3H3/t8-,9+,10-,11?,12?/m0/s1 |
| InChIKey | JFZGJEWHPMOJRH-IDSCEKSVSA-N |
| XLogP | -0.65 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol?
The IUPAC name of 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol (CID 166083245) is 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol.
What is the SMILES notation for 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol?
The canonical SMILES for 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol is COCC(O)OC[C@H]1OC[C@H](OC(O)COC)[C@H]1C.
What is the InChIKey of 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol?
The InChIKey is JFZGJEWHPMOJRH-IDSCEKSVSA-N. The full InChI is InChI=1S/C12H24O7/c1-8-9(4-18-11(13)6-15-2)17-5-10(8)19-12(14)7-16-3/h8-14H,4-7H2,1-3H3/t8-,9+,10-,11?,12?/m0/s1.
What are the key properties of 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol?
1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol has a molecular weight of 280.32 g/mol, XLogP of -0.65, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S,3S,4R)-4-(1-hydroxy-2-methoxyethoxy)-3-methyloxolan-2-yl]methoxy]-2-methoxyethanol is sourced from PubChem (CID 166083245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).