C23H21FN2O4S — CID 146402867
1-[2-(2-fluoro-4-phenylphenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (PubChem CID 146402867) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[2-(2-fluoro-4-phenylphenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
| Compound Name | 1-[2-(2-fluoro-4-phenylphenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
|---|---|
| PubChem CID | 146402867 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-[2-(2-fluoro-4-phenylphenyl)-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| SMILES | O=C(Cn1cc(S(=O)(=O)N2CCCC2)ccc1=O)c1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C23H21FN2O4S/c24-21-14-18(17-6-2-1-3-7-17)8-10-20(21)22(27)16-25-15-19(9-11-23(25)28)31(29,30)26-12-4-5-13-26/h1-3,6-11,14-15H,4-5,12-13,16H2 |
| InChIKey | IDKZHYXNPKPIHO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |