C25H24N2O4S — CID 146642613
1-[2-[4-(3-ethenylphenyl)phenyl]-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one (PubChem CID 146642613) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-[2-[4-(3-ethenylphenyl)phenyl]-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one.
| Compound Name | 1-[2-[4-(3-ethenylphenyl)phenyl]-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
|---|---|
| PubChem CID | 146642613 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-[2-[4-(3-ethenylphenyl)phenyl]-2-oxoethyl]-5-pyrrolidin-1-ylsulfonylpyridin-2-one |
| SMILES | C=Cc1cccc(-c2ccc(C(=O)Cn3cc(S(=O)(=O)N4CCCC4)ccc3=O)cc2)c1 |
| InChI | InChI=1S/C25H24N2O4S/c1-2-19-6-5-7-22(16-19)20-8-10-21(11-9-20)24(28)18-26-17-23(12-13-25(26)29)32(30,31)27-14-3-4-15-27/h2,5-13,16-17H,1,3-4,14-15,18H2 |
| InChIKey | CYIISFBMMNDOJM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |