About 2,2-diethyl-4,4-dimethyl-3H-chromene
2,2-diethyl-4,4-dimethyl-3H-chromene (PubChem CID 146403608) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,2-diethyl-4,4-dimethyl-3H-chromene.
Molecular Properties
| Compound Name | 2,2-diethyl-4,4-dimethyl-3H-chromene |
| PubChem CID | 146403608 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2,2-diethyl-4,4-dimethyl-3H-chromene |
| SMILES | CCC1(CC)CC(C)(C)c2ccccc2O1 |
| InChI | InChI=1S/C15H22O/c1-5-15(6-2)11-14(3,4)12-9-7-8-10-13(12)16-15/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | ALIILQPQIMJCOW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-diethyl-4,4-dimethyl-3H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-4,4-dimethyl-3H-chromene?
The IUPAC name of 2,2-diethyl-4,4-dimethyl-3H-chromene (CID 146403608) is 2,2-diethyl-4,4-dimethyl-3H-chromene.
What is the SMILES notation for 2,2-diethyl-4,4-dimethyl-3H-chromene?
The canonical SMILES for 2,2-diethyl-4,4-dimethyl-3H-chromene is CCC1(CC)CC(C)(C)c2ccccc2O1.
What is the InChIKey of 2,2-diethyl-4,4-dimethyl-3H-chromene?
The InChIKey is ALIILQPQIMJCOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-5-15(6-2)11-14(3,4)12-9-7-8-10-13(12)16-15/h7-10H,5-6,11H2,1-4H3.
What are the key properties of 2,2-diethyl-4,4-dimethyl-3H-chromene?
2,2-diethyl-4,4-dimethyl-3H-chromene has a molecular weight of 218.34 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-4,4-dimethyl-3H-chromene is sourced from PubChem (CID 146403608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).