C24H22N6O3 — CID 146403880
N-[4-[[6-(4-morpholin-2-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-2-pyridinyl]prop-2-enamide (PubChem CID 146403880) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[4-[[6-(4-morpholin-2-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-2-pyridinyl]prop-2-enamide.
| Compound Name | N-[4-[[6-(4-morpholin-2-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-2-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 146403880 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[4-[[6-(4-morpholin-2-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]-2-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Oc2ncnc3[nH]c(-c4ccc(C5CNCCO5)cc4)cc23)ccn1 |
| InChI | InChI=1S/C24H22N6O3/c1-2-22(31)30-21-11-17(7-8-26-21)33-24-18-12-19(29-23(18)27-14-28-24)15-3-5-16(6-4-15)20-13-25-9-10-32-20/h2-8,11-12,14,20,25H,1,9-10,13H2,(H,26,30,31)(H,27,28,29) |
| InChIKey | QNERRZRTDYBZLB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|