C23H23N5O2 — CID 175329846
N-[4-[6-(4-morpholin-2-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 175329846) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[4-[6-(4-morpholin-2-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[6-(4-morpholin-2-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175329846 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[4-[6-(4-morpholin-2-ylanilino)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2cc(Nc3ccc(C4CNCCO4)cc3)ncn2)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-2-23(29)28-19-7-3-16(4-8-19)20-13-22(26-15-25-20)27-18-9-5-17(6-10-18)21-14-24-11-12-30-21/h2-10,13,15,21,24H,1,11-12,14H2,(H,28,29)(H,25,26,27) |
| InChIKey | HRGYHBWNGSZRIA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|