C26H25N5O3 — CID 175201965
N-[3-[[6-[4-(morpholin-2-ylmethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 175201965) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[3-[[6-[4-(morpholin-2-ylmethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[6-[4-(morpholin-2-ylmethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175201965 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[3-[[6-[4-(morpholin-2-ylmethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2ncnc3[nH]c(-c4ccc(CC5CNCCO5)cc4)cc23)c1 |
| InChI | InChI=1S/C26H25N5O3/c1-2-24(32)30-19-4-3-5-20(13-19)34-26-22-14-23(31-25(22)28-16-29-26)18-8-6-17(7-9-18)12-21-15-27-10-11-33-21/h2-9,13-14,16,21,27H,1,10-12,15H2,(H,30,32)(H,28,29,31) |
| InChIKey | WXRDGRMQQPOYSO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|