C18H11ClN2O2 — CID 14640622
2-(chloromethyl)-3-phenylbenzo[f]benzimidazole-4,9-dione (PubChem CID 14640622) has the molecular formula C18H11ClN2O2 and a molecular weight of 322.75 g/mol. Its IUPAC name is 2-(chloromethyl)-3-phenylbenzo[f]benzimidazole-4,9-dione.
| Compound Name | 2-(chloromethyl)-3-phenylbenzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 14640622 |
| Molecular Formula | C18H11ClN2O2 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(chloromethyl)-3-phenylbenzo[f]benzimidazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1nc(CCl)n2-c1ccccc1 |
| InChI | InChI=1S/C18H11ClN2O2/c19-10-14-20-15-16(21(14)11-6-2-1-3-7-11)18(23)13-9-5-4-8-12(13)17(15)22/h1-9H,10H2 |
| InChIKey | LLQWLNAEWSMIGJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|