C28H27F5N4O3 — CID 146407423
2-[[4-[1-(1-butoxyethyl)-2-(6-fluoro-3-pyridinyl)imidazol-4-yl]-3-methoxyphenoxy]methyl]-3-fluoro-5-(trifluoromethyl)pyridine (PubChem CID 146407423) has the molecular formula C28H27F5N4O3 and a molecular weight of 562.54 g/mol. Its IUPAC name is 2-[[4-[1-(1-butoxyethyl)-2-(6-fluoro-3-pyridinyl)imidazol-4-yl]-3-methoxyphenoxy]methyl]-3-fluoro-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[[4-[1-(1-butoxyethyl)-2-(6-fluoro-3-pyridinyl)imidazol-4-yl]-3-methoxyphenoxy]methyl]-3-fluoro-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 146407423 |
| Molecular Formula | C28H27F5N4O3 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 2-[[4-[1-(1-butoxyethyl)-2-(6-fluoro-3-pyridinyl)imidazol-4-yl]-3-methoxyphenoxy]methyl]-3-fluoro-5-(trifluoromethyl)pyridine |
| SMILES | CCCCOC(C)n1cc(-c2ccc(OCc3ncc(C(F)(F)F)cc3F)cc2OC)nc1-c1ccc(F)nc1 |
| InChI | InChI=1S/C28H27F5N4O3/c1-4-5-10-39-17(2)37-15-23(36-27(37)18-6-9-26(30)35-13-18)21-8-7-20(12-25(21)38-3)40-16-24-22(29)11-19(14-34-24)28(31,32)33/h6-9,11-15,17H,4-5,10,16H2,1-3H3 |
| InChIKey | KINLPHMDRJLVOF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|