C23H21ClN4O2 — CID 158183064
2-chloro-5-[4-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1-methylimidazol-2-yl]pyridine (PubChem CID 158183064) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-chloro-5-[4-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1-methylimidazol-2-yl]pyridine.
| Compound Name | 2-chloro-5-[4-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1-methylimidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 158183064 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-chloro-5-[4-[2-methoxy-4-[(5-methyl-2-pyridinyl)methoxy]phenyl]-1-methylimidazol-2-yl]pyridine |
| SMILES | COc1cc(OCc2ccc(C)cn2)ccc1-c1cn(C)c(-c2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-15-4-6-17(25-11-15)14-30-18-7-8-19(21(10-18)29-3)20-13-28(2)23(27-20)16-5-9-22(24)26-12-16/h4-13H,14H2,1-3H3 |
| InChIKey | FYVFIYYCJZJBLU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|