C22H23Cl2FN4O3 — CID 146408183
N-[2-[[5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]pyrimidin-2-yl]amino]cyclopentyl]prop-2-enamide (PubChem CID 146408183) has the molecular formula C22H23Cl2FN4O3 and a molecular weight of 481.36 g/mol. Its IUPAC name is N-[2-[[5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]pyrimidin-2-yl]amino]cyclopentyl]prop-2-enamide.
| Compound Name | N-[2-[[5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]pyrimidin-2-yl]amino]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 146408183 |
| Molecular Formula | C22H23Cl2FN4O3 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-[2-[[5-[(Z)-2-(2,6-dichloro-3,5-dimethoxyphenyl)-2-fluoroethenyl]pyrimidin-2-yl]amino]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCC1Nc1ncc(/C=C(\F)c2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C22H23Cl2FN4O3/c1-4-18(30)28-14-6-5-7-15(14)29-22-26-10-12(11-27-22)8-13(25)19-20(23)16(31-2)9-17(32-3)21(19)24/h4,8-11,14-15H,1,5-7H2,2-3H3,(H,28,30)(H,26,27,29)/b13-8- |
| InChIKey | CNCUDRAUQFPBLA-JYRVWZFOSA-N |
| XLogP | 4.90 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|