C10H10N4S2 — CID 146408285
6-anilino-4-methylsulfanyl-1H-1,3,5-triazine-2-thione (PubChem CID 146408285) has the molecular formula C10H10N4S2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 6-anilino-4-methylsulfanyl-1H-1,3,5-triazine-2-thione.
| Compound Name | 6-anilino-4-methylsulfanyl-1H-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 146408285 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 6-anilino-4-methylsulfanyl-1H-1,3,5-triazine-2-thione |
| SMILES | CSc1nc(Nc2ccccc2)[nH]c(=S)n1 |
| InChI | InChI=1S/C10H10N4S2/c1-16-10-13-8(12-9(15)14-10)11-7-5-3-2-4-6-7/h2-6H,1H3,(H2,11,12,13,14,15) |
| InChIKey | YOGYMWYTPGYZGH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|