C10H10N4OS2 — CID 54351185
6-(4-methoxyanilino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 54351185) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-(4-methoxyanilino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(4-methoxyanilino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 54351185 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-(4-methoxyanilino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | COc1ccc(Nc2nc(=S)[nH]c(=S)[nH]2)cc1 |
| InChI | InChI=1S/C10H10N4OS2/c1-15-7-4-2-6(3-5-7)11-8-12-9(16)14-10(17)13-8/h2-5H,1H3,(H3,11,12,13,14,16,17) |
| InChIKey | UFWRRZLOCILKCO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|