C11H13N5S — CID 102439735
2-anilino-6-(dimethylamino)-1H-1,3,5-triazine-4-thione (PubChem CID 102439735) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-anilino-6-(dimethylamino)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-anilino-6-(dimethylamino)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 102439735 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-anilino-6-(dimethylamino)-1H-1,3,5-triazine-4-thione |
| SMILES | CN(C)c1nc(=S)nc(Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H13N5S/c1-16(2)10-13-9(14-11(17)15-10)12-8-6-4-3-5-7-8/h3-7H,1-2H3,(H2,12,13,14,15,17) |
| InChIKey | RMJGGBBLFNMJTL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|