C22H29N5O3 — CID 146410382
2-(2-methoxyethoxy)-9-[[4-(2-pyrrolidin-1-ylpropan-2-yl)phenyl]methyl]-7H-purin-8-one (PubChem CID 146410382) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-9-[[4-(2-pyrrolidin-1-ylpropan-2-yl)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-(2-methoxyethoxy)-9-[[4-(2-pyrrolidin-1-ylpropan-2-yl)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 146410382 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-(2-methoxyethoxy)-9-[[4-(2-pyrrolidin-1-ylpropan-2-yl)phenyl]methyl]-7H-purin-8-one |
| SMILES | COCCOc1ncc2[nH]c(=O)n(Cc3ccc(C(C)(C)N4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C22H29N5O3/c1-22(2,26-10-4-5-11-26)17-8-6-16(7-9-17)15-27-19-18(24-21(27)28)14-23-20(25-19)30-13-12-29-3/h6-9,14H,4-5,10-13,15H2,1-3H3,(H,24,28) |
| InChIKey | NBYZXIMRMBNJLU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|