C24H32N6O3 — CID 178100262
2-butoxy-9-[[4-[2-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethoxy]phenyl]methyl]-7H-purin-8-one (PubChem CID 178100262) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-butoxy-9-[[4-[2-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethoxy]phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-butoxy-9-[[4-[2-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethoxy]phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 178100262 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-butoxy-9-[[4-[2-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)ethoxy]phenyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1ncc2[nH]c(=O)n(Cc3ccc(OCCN4CC5CC4CN5C)cc3)c2n1 |
| InChI | InChI=1S/C24H32N6O3/c1-3-4-10-33-23-25-13-21-22(27-23)30(24(31)26-21)14-17-5-7-20(8-6-17)32-11-9-29-16-18-12-19(29)15-28(18)2/h5-8,13,18-19H,3-4,9-12,14-16H2,1-2H3,(H,26,31) |
| InChIKey | PXFGHIXZAPSSHL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|