C32H47N7O5 — CID 169083292
9-[[4-[[4-[1-[3-(2-aminooxyethoxy)propanoyl]piperidin-4-yl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one (PubChem CID 169083292) has the molecular formula C32H47N7O5 and a molecular weight of 609.77 g/mol. Its IUPAC name is 9-[[4-[[4-[1-[3-(2-aminooxyethoxy)propanoyl]piperidin-4-yl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one.
| Compound Name | 9-[[4-[[4-[1-[3-(2-aminooxyethoxy)propanoyl]piperidin-4-yl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one |
|---|---|
| PubChem CID | 169083292 |
| Molecular Formula | C32H47N7O5 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | 9-[[4-[[4-[1-[3-(2-aminooxyethoxy)propanoyl]piperidin-4-yl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one |
| SMILES | CCCCOc1ncc2[nH]c(=O)n(Cc3ccc(CN4CCC(C5CCN(C(=O)CCOCCON)CC5)CC4)cc3)c2n1 |
| InChI | InChI=1S/C32H47N7O5/c1-2-3-17-43-31-34-21-28-30(36-31)39(32(41)35-28)23-25-6-4-24(5-7-25)22-37-13-8-26(9-14-37)27-10-15-38(16-11-27)29(40)12-18-42-19-20-44-33/h4-7,21,26-27H,2-3,8-20,22-23,33H2,1H3,(H,35,41) |
| InChIKey | ZJLHBNQRCMMMOE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|