C19H26N6O2S — CID 175801683
2-butoxy-9-[[5-(piperazin-1-ylmethyl)thiophen-2-yl]methyl]-7H-purin-8-one (PubChem CID 175801683) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-butoxy-9-[[5-(piperazin-1-ylmethyl)thiophen-2-yl]methyl]-7H-purin-8-one.
| Compound Name | 2-butoxy-9-[[5-(piperazin-1-ylmethyl)thiophen-2-yl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 175801683 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-butoxy-9-[[5-(piperazin-1-ylmethyl)thiophen-2-yl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1ncc2[nH]c(=O)n(Cc3ccc(CN4CCNCC4)s3)c2n1 |
| InChI | InChI=1S/C19H26N6O2S/c1-2-3-10-27-18-21-11-16-17(23-18)25(19(26)22-16)13-15-5-4-14(28-15)12-24-8-6-20-7-9-24/h4-5,11,20H,2-3,6-10,12-13H2,1H3,(H,22,26) |
| InChIKey | ZQQZTGKHLOVOOG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|