C23H28N8O4S — CID 167226421
[1-[[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]thiophen-2-yl]methyl]pyrrolidin-3-yl] imidazole-1-carboxylate (PubChem CID 167226421) has the molecular formula C23H28N8O4S and a molecular weight of 512.60 g/mol. Its IUPAC name is [1-[[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]thiophen-2-yl]methyl]pyrrolidin-3-yl] imidazole-1-carboxylate.
| Compound Name | [1-[[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]thiophen-2-yl]methyl]pyrrolidin-3-yl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 167226421 |
| Molecular Formula | C23H28N8O4S |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [1-[[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]thiophen-2-yl]methyl]pyrrolidin-3-yl] imidazole-1-carboxylate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(OC(=O)n5ccnc5)C4)s3)c2n1 |
| InChI | InChI=1S/C23H28N8O4S/c1-2-3-10-34-21-27-19(24)18-20(28-21)31(22(32)26-18)13-17-5-4-16(36-17)12-29-8-6-15(11-29)35-23(33)30-9-7-25-14-30/h4-5,7,9,14-15H,2-3,6,8,10-13H2,1H3,(H,26,32)(H2,24,27,28) |
| InChIKey | CDYRBTCYACNMQP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 146.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|