C24H30N2O5S — CID 146413217
2,2-dimethyl-3-[4-methyl-3-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]phenyl]propanoic acid (PubChem CID 146413217) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-methyl-3-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]phenyl]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[4-methyl-3-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146413217 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2,2-dimethyl-3-[4-methyl-3-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(CC(C)(C)C(=O)O)cc1CN1CC2(CCOCC2)Oc2ncccc2S1=O |
| InChI | InChI=1S/C24H30N2O5S/c1-17-6-7-18(14-23(2,3)22(27)28)13-19(17)15-26-16-24(8-11-30-12-9-24)31-21-20(32(26)29)5-4-10-25-21/h4-7,10,13H,8-9,11-12,14-16H2,1-3H3,(H,27,28) |
| InChIKey | HYVYQOMHXJZETF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |