C6H12N2O2 — CID 14641509
(2S)-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 14641509) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 14641509 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C6H12N2O2/c7-6(10)8-3-1-2-5(8)4-9/h5,9H,1-4H2,(H2,7,10)/t5-/m0/s1 |
| InChIKey | DLKMVGSBOOTVRL-YFKPBYRVSA-N |
| XLogP | -0.48 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |