C9H15F3N2O3 — CID 99579589
(2R)-2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide (PubChem CID 99579589) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is (2R)-2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99579589 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2R)-2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide |
| SMILES | O=C(NOCCC(F)(F)F)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C9H15F3N2O3/c10-9(11,12)3-5-17-13-8(16)14-4-1-2-7(14)6-15/h7,15H,1-6H2,(H,13,16)/t7-/m1/s1 |
| InChIKey | GTGRTAKLIGHNTF-SSDOTTSWSA-N |
| XLogP | 1.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|