C9H14N2 — CID 146415622
N-ethyl-3,6-dimethylpyridin-2-amine (PubChem CID 146415622) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-ethyl-3,6-dimethylpyridin-2-amine.
| Compound Name | N-ethyl-3,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 146415622 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-ethyl-3,6-dimethylpyridin-2-amine |
| SMILES | CCNc1nc(C)ccc1C |
| InChI | InChI=1S/C9H14N2/c1-4-10-9-7(2)5-6-8(3)11-9/h5-6H,4H2,1-3H3,(H,10,11) |
| InChIKey | LOMSAJQFAOSMIM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |