C19H22FN7O2 — CID 146416173
2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide (PubChem CID 146416173) has the molecular formula C19H22FN7O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | 2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 146416173 |
| Molecular Formula | C19H22FN7O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-methyl-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCn1nc(C)c(F)c1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1CCCN3C |
| InChI | InChI=1S/C19H22FN7O2/c1-4-27-16(14(20)10(2)24-27)18(29)23-19-22-12-8-11(17(21)28)9-13-15(12)26(19)7-5-6-25(13)3/h8-9H,4-7H2,1-3H3,(H2,21,28)(H,22,23,29) |
| InChIKey | DVKVETQHJRNCMX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |