C24H29F4N7O3 — CID 146416277
(11R)-2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-(3-methoxypropyl)-11-methyl-11-(trifluoromethyl)-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide (PubChem CID 146416277) has the molecular formula C24H29F4N7O3 and a molecular weight of 539.53 g/mol. Its IUPAC name is (11R)-2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-(3-methoxypropyl)-11-methyl-11-(trifluoromethyl)-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide.
| Compound Name | (11R)-2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-(3-methoxypropyl)-11-methyl-11-(trifluoromethyl)-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 146416277 |
| Molecular Formula | C24H29F4N7O3 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | (11R)-2-[(1-ethyl-4-fluoro-3-methylpyrazole-5-carbonyl)amino]-9-(3-methoxypropyl)-11-methyl-11-(trifluoromethyl)-1,3,9-triazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraene-6-carboxamide |
| SMILES | CCn1nc(C)c(F)c1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1C[C@](C)(C(F)(F)F)CN3CCCOC |
| InChI | InChI=1S/C24H29F4N7O3/c1-5-35-19(17(25)13(2)32-35)21(37)31-22-30-15-9-14(20(29)36)10-16-18(15)34(22)12-23(3,24(26,27)28)11-33(16)7-6-8-38-4/h9-10H,5-8,11-12H2,1-4H3,(H2,29,36)(H,30,31,37)/t23-/m1/s1 |
| InChIKey | KYHGKXZCWMJCJC-HSZRJFAPSA-N |
| XLogP | 3.48 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|