C19H20N6O3 — CID 156543717
2-[(4-ethenyl-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 156543717) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-[(4-ethenyl-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | 2-[(4-ethenyl-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 156543717 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[(4-ethenyl-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | C=Cc1c(C)nn(CC)c1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1CCO3 |
| InChI | InChI=1S/C19H20N6O3/c1-4-12-10(3)23-25(5-2)15(12)18(27)22-19-21-13-8-11(17(20)26)9-14-16(13)24(19)6-7-28-14/h4,8-9H,1,5-7H2,2-3H3,(H2,20,26)(H,21,22,27) |
| InChIKey | RNYVNBCFWQLTCF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |