C22H29N5O4 — CID 153387183
2-ethyl-5-methylpyrazole-3-carbaldehyde;methyl 2-(methylamino)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate;prop-1-ene (PubChem CID 153387183) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-ethyl-5-methylpyrazole-3-carbaldehyde;methyl 2-(methylamino)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate;prop-1-ene.
| Compound Name | 2-ethyl-5-methylpyrazole-3-carbaldehyde;methyl 2-(methylamino)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate;prop-1-ene |
|---|---|
| PubChem CID | 153387183 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-ethyl-5-methylpyrazole-3-carbaldehyde;methyl 2-(methylamino)-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate;prop-1-ene |
| SMILES | C=CC.CCn1nc(C)cc1C=O.CNc1nc2cc(C(=O)OC)cc3c2n1CCO3 |
| InChI | InChI=1S/C12H13N3O3.C7H10N2O.C3H6/c1-13-12-14-8-5-7(11(16)17-2)6-9-10(8)15(12)3-4-18-9;1-3-9-7(5-10)4-6(2)8-9;1-3-2/h5-6H,3-4H2,1-2H3,(H,13,14);4-5H,3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | DJFLJDFHWWIFIH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|